C9H12FN — CID 167163288
N-[(3E)-3-fluorohexa-1,3-dien-2-yl]prop-2-en-1-imine (PubChem CID 167163288) has the molecular formula C9H12FN and a molecular weight of 153.20 g/mol. Its IUPAC name is N-[(3E)-3-fluorohexa-1,3-dien-2-yl]prop-2-en-1-imine.
| Compound Name | N-[(3E)-3-fluorohexa-1,3-dien-2-yl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 167163288 |
| Molecular Formula | C9H12FN |
| Molecular Weight | 153.20 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | N-[(3E)-3-fluorohexa-1,3-dien-2-yl]prop-2-en-1-imine |
| SMILES | C=C/C=N/C(=C)/C(F)=C\CC |
| InChI | InChI=1S/C9H12FN/c1-4-6-9(10)8(3)11-7-5-2/h5-7H,2-4H2,1H3/b9-6+,11-7+ |
| InChIKey | AYGUUYSIACTSFM-QHAIXMIYSA-N |
| XLogP | 3.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.20 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|