About 3-ethenyl-2,4,5-trimethylfuran
3-ethenyl-2,4,5-trimethylfuran (PubChem CID 167164400) has the molecular formula C9H12O
and a molecular weight of 136.19 g/mol. Its IUPAC name is 3-ethenyl-2,4,5-trimethylfuran.
Molecular Properties
| Compound Name | 3-ethenyl-2,4,5-trimethylfuran |
| PubChem CID | 167164400 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 3-ethenyl-2,4,5-trimethylfuran |
| SMILES | C=Cc1c(C)oc(C)c1C |
| InChI | InChI=1S/C9H12O/c1-5-9-6(2)7(3)10-8(9)4/h5H,1H2,2-4H3 |
| InChIKey | KSJVDALSDHWFRV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethenyl-2,4,5-trimethylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-2,4,5-trimethylfuran?
The IUPAC name of 3-ethenyl-2,4,5-trimethylfuran (CID 167164400) is 3-ethenyl-2,4,5-trimethylfuran.
What is the SMILES notation for 3-ethenyl-2,4,5-trimethylfuran?
The canonical SMILES for 3-ethenyl-2,4,5-trimethylfuran is C=Cc1c(C)oc(C)c1C.
What is the InChIKey of 3-ethenyl-2,4,5-trimethylfuran?
The InChIKey is KSJVDALSDHWFRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O/c1-5-9-6(2)7(3)10-8(9)4/h5H,1H2,2-4H3.
What are the key properties of 3-ethenyl-2,4,5-trimethylfuran?
3-ethenyl-2,4,5-trimethylfuran has a molecular weight of 136.19 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-2,4,5-trimethylfuran is sourced from PubChem (CID 167164400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).