C19H36F2 — CID 167169464
(E)-4-(1,1-difluoropropan-2-yl)-5,7,7,8,8-pentamethylundec-3-ene (PubChem CID 167169464) has the molecular formula C19H36F2 and a molecular weight of 302.49 g/mol. Its IUPAC name is (E)-4-(1,1-difluoropropan-2-yl)-5,7,7,8,8-pentamethylundec-3-ene.
| Compound Name | (E)-4-(1,1-difluoropropan-2-yl)-5,7,7,8,8-pentamethylundec-3-ene |
|---|---|
| PubChem CID | 167169464 |
| Molecular Formula | C19H36F2 |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.28 |
| IUPAC Name | (E)-4-(1,1-difluoropropan-2-yl)-5,7,7,8,8-pentamethylundec-3-ene |
| SMILES | CC/C=C(\C(C)CC(C)(C)C(C)(C)CCC)C(C)C(F)F |
| InChI | InChI=1S/C19H36F2/c1-9-11-16(15(4)17(20)21)14(3)13-19(7,8)18(5,6)12-10-2/h11,14-15,17H,9-10,12-13H2,1-8H3/b16-11+ |
| InChIKey | HSBKAORHBFYDFF-LFIBNONCSA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|