C9H12F5N — CID 167172097
(Z)-7,7,8,8,8-pentafluoro-N-methyloct-2-en-4-imine (PubChem CID 167172097) has the molecular formula C9H12F5N and a molecular weight of 229.19 g/mol. Its IUPAC name is (Z)-7,7,8,8,8-pentafluoro-N-methyloct-2-en-4-imine.
| Compound Name | (Z)-7,7,8,8,8-pentafluoro-N-methyloct-2-en-4-imine |
|---|---|
| PubChem CID | 167172097 |
| Molecular Formula | C9H12F5N |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | (Z)-7,7,8,8,8-pentafluoro-N-methyloct-2-en-4-imine |
| SMILES | C/C=C\C(CCC(F)(F)C(F)(F)F)=N/C |
| InChI | InChI=1S/C9H12F5N/c1-3-4-7(15-2)5-6-8(10,11)9(12,13)14/h3-4H,5-6H2,1-2H3/b4-3-,15-7+ |
| InChIKey | QPJHEMSFKPRHKQ-VDSXDIJOSA-N |
| XLogP | 3.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|