C12H15Cl2N3O — CID 167172639
(10R)-5,6-dichloro-12-ethyl-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene (PubChem CID 167172639) has the molecular formula C12H15Cl2N3O and a molecular weight of 288.18 g/mol. Its IUPAC name is (10R)-5,6-dichloro-12-ethyl-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene.
| Compound Name | (10R)-5,6-dichloro-12-ethyl-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
|---|---|
| PubChem CID | 167172639 |
| Molecular Formula | C12H15Cl2N3O |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | (10R)-5,6-dichloro-12-ethyl-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
| SMILES | CCN1CCN2c3ncc(Cl)c(Cl)c3OC[C@H]2C1 |
| InChI | InChI=1S/C12H15Cl2N3O/c1-2-16-3-4-17-8(6-16)7-18-11-10(14)9(13)5-15-12(11)17/h5,8H,2-4,6-7H2,1H3/t8-/m1/s1 |
| InChIKey | KKEUNGYAGDTRQF-MRVPVSSYSA-N |
| XLogP | 2.29 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |