C13H15N5 — CID 167172658
11-propan-2-yl-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-5-carbonitrile (PubChem CID 167172658) has the molecular formula C13H15N5 and a molecular weight of 241.30 g/mol. Its IUPAC name is 11-propan-2-yl-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-5-carbonitrile.
| Compound Name | 11-propan-2-yl-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-5-carbonitrile |
|---|---|
| PubChem CID | 167172658 |
| Molecular Formula | C13H15N5 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 11-propan-2-yl-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-5-carbonitrile |
| SMILES | CC(C)N1CCn2c(nc3cc(C#N)cnc32)C1 |
| InChI | InChI=1S/C13H15N5/c1-9(2)17-3-4-18-12(8-17)16-11-5-10(6-14)7-15-13(11)18/h5,7,9H,3-4,8H2,1-2H3 |
| InChIKey | DIGFTSRRVJUENI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 57.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |