C17H23N5S — CID 167172713
5-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-11-methylsulfanyl-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene (PubChem CID 167172713) has the molecular formula C17H23N5S and a molecular weight of 329.47 g/mol. Its IUPAC name is 5-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-11-methylsulfanyl-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene.
| Compound Name | 5-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-11-methylsulfanyl-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene |
|---|---|
| PubChem CID | 167172713 |
| Molecular Formula | C17H23N5S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 5-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-11-methylsulfanyl-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene |
| SMILES | CSN1CCn2c(nc3cc(N4CC5CCCC5C4)cnc32)C1 |
| InChI | InChI=1S/C17H23N5S/c1-23-21-5-6-22-16(11-21)19-15-7-14(8-18-17(15)22)20-9-12-3-2-4-13(12)10-20/h7-8,12-13H,2-6,9-11H2,1H3 |
| InChIKey | TYUSSKSRDBEVJW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|