C15H16F3N3O2 — CID 167172778
1-[(6aR)-5-hydroxy-3-(trifluoromethyl)-5,6,6a,7,9,10-hexahydropyrazino[1,2-a][1,8]naphthyridin-8-yl]prop-2-en-1-one (PubChem CID 167172778) has the molecular formula C15H16F3N3O2 and a molecular weight of 327.31 g/mol. Its IUPAC name is 1-[(6aR)-5-hydroxy-3-(trifluoromethyl)-5,6,6a,7,9,10-hexahydropyrazino[1,2-a][1,8]naphthyridin-8-yl]prop-2-en-1-one.
| Compound Name | 1-[(6aR)-5-hydroxy-3-(trifluoromethyl)-5,6,6a,7,9,10-hexahydropyrazino[1,2-a][1,8]naphthyridin-8-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167172778 |
| Molecular Formula | C15H16F3N3O2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-[(6aR)-5-hydroxy-3-(trifluoromethyl)-5,6,6a,7,9,10-hexahydropyrazino[1,2-a][1,8]naphthyridin-8-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN2c3ncc(C(F)(F)F)cc3C(O)C[C@@H]2C1 |
| InChI | InChI=1S/C15H16F3N3O2/c1-2-13(23)20-3-4-21-10(8-20)6-12(22)11-5-9(15(16,17)18)7-19-14(11)21/h2,5,7,10,12,22H,1,3-4,6,8H2/t10-,12?/m1/s1 |
| InChIKey | AMLIBLKBFDZNQB-RWANSRKNSA-N |
| XLogP | 1.74 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|