C15H16F3N3O2 — CID 167172770
1-[(9S)-8-hydroxy-8-methyl-5-(trifluoromethyl)-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-11-yl]prop-2-en-1-one (PubChem CID 167172770) has the molecular formula C15H16F3N3O2 and a molecular weight of 327.31 g/mol. Its IUPAC name is 1-[(9S)-8-hydroxy-8-methyl-5-(trifluoromethyl)-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-11-yl]prop-2-en-1-one.
| Compound Name | 1-[(9S)-8-hydroxy-8-methyl-5-(trifluoromethyl)-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-11-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167172770 |
| Molecular Formula | C15H16F3N3O2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-[(9S)-8-hydroxy-8-methyl-5-(trifluoromethyl)-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-11-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN2c3ncc(C(F)(F)F)cc3C(C)(O)[C@@H]2C1 |
| InChI | InChI=1S/C15H16F3N3O2/c1-3-12(22)20-4-5-21-11(8-20)14(2,23)10-6-9(15(16,17)18)7-19-13(10)21/h3,6-7,11,23H,1,4-5,8H2,2H3/t11-,14?/m0/s1 |
| InChIKey | KFXSLWXUQKWQAQ-ZSOXZCCMSA-N |
| XLogP | 1.52 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|