C17H18F3N3O2 — CID 172543334
(9aR)-8-prop-2-enoyl-2-[4-(trifluoromethyl)phenyl]-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-4-one (PubChem CID 172543334) has the molecular formula C17H18F3N3O2 and a molecular weight of 353.34 g/mol. Its IUPAC name is (9aR)-8-prop-2-enoyl-2-[4-(trifluoromethyl)phenyl]-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-4-one.
| Compound Name | (9aR)-8-prop-2-enoyl-2-[4-(trifluoromethyl)phenyl]-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 172543334 |
| Molecular Formula | C17H18F3N3O2 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | (9aR)-8-prop-2-enoyl-2-[4-(trifluoromethyl)phenyl]-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-4-one |
| SMILES | C=CC(=O)N1CCN2C(=O)CN(c3ccc(C(F)(F)F)cc3)C[C@@H]2C1 |
| InChI | InChI=1S/C17H18F3N3O2/c1-2-15(24)21-7-8-23-14(9-21)10-22(11-16(23)25)13-5-3-12(4-6-13)17(18,19)20/h2-6,14H,1,7-11H2/t14-/m0/s1 |
| InChIKey | KWDQVUDLKCFRMK-AWEZNQCLSA-N |
| XLogP | 1.75 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|