C27H19FN4O3S2 — CID 16717823
N-[[3-fluoro-4-[2-(1-oxidopyridin-1-ium-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide (PubChem CID 16717823) has the molecular formula C27H19FN4O3S2 and a molecular weight of 530.61 g/mol. Its IUPAC name is N-[[3-fluoro-4-[2-(1-oxidopyridin-1-ium-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide.
| Compound Name | N-[[3-fluoro-4-[2-(1-oxidopyridin-1-ium-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 16717823 |
| Molecular Formula | C27H19FN4O3S2 |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | N-[[3-fluoro-4-[2-(1-oxidopyridin-1-ium-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NC(=S)Nc1ccc(Oc2ccnc3cc(-c4cccc[n+]4[O-])sc23)c(F)c1 |
| InChI | InChI=1S/C27H19FN4O3S2/c28-19-15-18(30-27(36)31-25(33)14-17-6-2-1-3-7-17)9-10-22(19)35-23-11-12-29-20-16-24(37-26(20)23)21-8-4-5-13-32(21)34/h1-13,15-16H,14H2,(H2,30,31,33,36) |
| InChIKey | LVFRZTAALOBNRB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|