C28H19F2N5O2S2 — CID 16718015
2-(2-ethynyl-4-fluorophenyl)-N-[[3-fluoro-4-[2-(1-methylimidazol-4-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]acetamide (PubChem CID 16718015) has the molecular formula C28H19F2N5O2S2 and a molecular weight of 559.62 g/mol. Its IUPAC name is 2-(2-ethynyl-4-fluorophenyl)-N-[[3-fluoro-4-[2-(1-methylimidazol-4-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]acetamide.
| Compound Name | 2-(2-ethynyl-4-fluorophenyl)-N-[[3-fluoro-4-[2-(1-methylimidazol-4-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 16718015 |
| Molecular Formula | C28H19F2N5O2S2 |
| Molecular Weight | 559.62 g/mol |
| Exact Mass | 559.09 |
| IUPAC Name | 2-(2-ethynyl-4-fluorophenyl)-N-[[3-fluoro-4-[2-(1-methylimidazol-4-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]acetamide |
| SMILES | C#Cc1cc(F)ccc1CC(=O)NC(=S)Nc1ccc(Oc2ccnc3cc(-c4cn(C)cn4)sc23)c(F)c1 |
| InChI | InChI=1S/C28H19F2N5O2S2/c1-3-16-10-18(29)5-4-17(16)11-26(36)34-28(38)33-19-6-7-23(20(30)12-19)37-24-8-9-31-21-13-25(39-27(21)24)22-14-35(2)15-32-22/h1,4-10,12-15H,11H2,2H3,(H2,33,34,36,38) |
| InChIKey | KABJKVHTDXGNLO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.62 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|