C29H22FN5O2S2 — CID 59457738
2-(2-ethynyl-4-methylphenyl)-N-[[3-fluoro-4-[2-(1-methylimidazol-4-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]acetamide (PubChem CID 59457738) has the molecular formula C29H22FN5O2S2 and a molecular weight of 555.66 g/mol. Its IUPAC name is 2-(2-ethynyl-4-methylphenyl)-N-[[3-fluoro-4-[2-(1-methylimidazol-4-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]acetamide.
| Compound Name | 2-(2-ethynyl-4-methylphenyl)-N-[[3-fluoro-4-[2-(1-methylimidazol-4-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 59457738 |
| Molecular Formula | C29H22FN5O2S2 |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | 2-(2-ethynyl-4-methylphenyl)-N-[[3-fluoro-4-[2-(1-methylimidazol-4-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]acetamide |
| SMILES | C#Cc1cc(C)ccc1CC(=O)NC(=S)Nc1ccc(Oc2ccnc3cc(-c4cn(C)cn4)sc23)c(F)c1 |
| InChI | InChI=1S/C29H22FN5O2S2/c1-4-18-11-17(2)5-6-19(18)12-27(36)34-29(38)33-20-7-8-24(21(30)13-20)37-25-9-10-31-22-14-26(39-28(22)25)23-15-35(3)16-32-23/h1,5-11,13-16H,12H2,2-3H3,(H2,33,34,36,38) |
| InChIKey | KDCKOLKXEBWCTO-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|