C34H44Cl2O4 — CID 167181567
1-tert-butyl-3-[2-[5-[5-(2,3-dichlorophenyl)-2,5-dimethylhexan-2-yl]-2-methoxyphenoxy]ethoxy]-5-methoxybenzene (PubChem CID 167181567) has the molecular formula C34H44Cl2O4 and a molecular weight of 587.63 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-[5-[5-(2,3-dichlorophenyl)-2,5-dimethylhexan-2-yl]-2-methoxyphenoxy]ethoxy]-5-methoxybenzene.
| Compound Name | 1-tert-butyl-3-[2-[5-[5-(2,3-dichlorophenyl)-2,5-dimethylhexan-2-yl]-2-methoxyphenoxy]ethoxy]-5-methoxybenzene |
|---|---|
| PubChem CID | 167181567 |
| Molecular Formula | C34H44Cl2O4 |
| Molecular Weight | 587.63 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | 1-tert-butyl-3-[2-[5-[5-(2,3-dichlorophenyl)-2,5-dimethylhexan-2-yl]-2-methoxyphenoxy]ethoxy]-5-methoxybenzene |
| SMILES | COc1cc(OCCOc2cc(C(C)(C)CCC(C)(C)c3cccc(Cl)c3Cl)ccc2OC)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C34H44Cl2O4/c1-32(2,3)24-19-25(37-8)22-26(20-24)39-17-18-40-30-21-23(13-14-29(30)38-9)33(4,5)15-16-34(6,7)27-11-10-12-28(35)31(27)36/h10-14,19-22H,15-18H2,1-9H3 |
| InChIKey | IEEGZFPODLAJPD-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.63 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|