C16H29N — CID 167182420
3,6,9-trimethylidenetridecan-1-amine (PubChem CID 167182420) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is 3,6,9-trimethylidenetridecan-1-amine.
| Compound Name | 3,6,9-trimethylidenetridecan-1-amine |
|---|---|
| PubChem CID | 167182420 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | 3,6,9-trimethylidenetridecan-1-amine |
| SMILES | C=C(CCN)CCC(=C)CCC(=C)CCCC |
| InChI | InChI=1S/C16H29N/c1-5-6-7-14(2)8-9-15(3)10-11-16(4)12-13-17/h2-13,17H2,1H3 |
| InChIKey | ICUNTMWNKFBDOX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|