C25H43N — CID 167190857
4-methyl-2-[(5Z,7E)-3-(2-methyl-4-methylidene-2-prop-1-en-2-ylhexyl)nona-5,7-dien-2-yl]pyrrolidine (PubChem CID 167190857) has the molecular formula C25H43N and a molecular weight of 357.63 g/mol. Its IUPAC name is 4-methyl-2-[(5Z,7E)-3-(2-methyl-4-methylidene-2-prop-1-en-2-ylhexyl)nona-5,7-dien-2-yl]pyrrolidine.
| Compound Name | 4-methyl-2-[(5Z,7E)-3-(2-methyl-4-methylidene-2-prop-1-en-2-ylhexyl)nona-5,7-dien-2-yl]pyrrolidine |
|---|---|
| PubChem CID | 167190857 |
| Molecular Formula | C25H43N |
| Molecular Weight | 357.63 g/mol |
| Exact Mass | 357.34 |
| IUPAC Name | 4-methyl-2-[(5Z,7E)-3-(2-methyl-4-methylidene-2-prop-1-en-2-ylhexyl)nona-5,7-dien-2-yl]pyrrolidine |
| SMILES | C=C(CC)CC(C)(CC(C/C=C\C=C\C)C(C)C1CC(C)CN1)C(=C)C |
| InChI | InChI=1S/C25H43N/c1-9-11-12-13-14-23(22(7)24-15-21(6)18-26-24)17-25(8,19(3)4)16-20(5)10-2/h9,11-13,21-24,26H,3,5,10,14-18H2,1-2,4,6-8H3/b11-9+,13-12- |
| InChIKey | JQMBDLWVPMUERS-ZFDSPDROSA-N |
| XLogP | 7.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.63 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|