C18H30O — CID 16719663
(1R)-1-[(1R,2R,7S,8S,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl]but-3-en-1-ol (PubChem CID 16719663) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is (1R)-1-[(1R,2R,7S,8S,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl]but-3-en-1-ol.
| Compound Name | (1R)-1-[(1R,2R,7S,8S,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl]but-3-en-1-ol |
|---|---|
| PubChem CID | 16719663 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | (1R)-1-[(1R,2R,7S,8S,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl]but-3-en-1-ol |
| SMILES | C=CC[C@@H](O)[C@H]1[C@H]2CC[C@@H]3[C@@H]2C(C)(C)CCC[C@]13C |
| InChI | InChI=1S/C18H30O/c1-5-7-14(19)16-12-8-9-13-15(12)17(2,3)10-6-11-18(13,16)4/h5,12-16,19H,1,6-11H2,2-4H3/t12-,13+,14+,15+,16+,18-/m0/s1 |
| InChIKey | DCSAZFQRSSTDDI-AIVZJVSBSA-N |
| XLogP | 4.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|