C34H60Cl2NPZn — CID 11093515
N-[bis[[(1R,2R,7S,8R,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl]methyl]phosphanyl]-N-ethylethanamine;dichlorozinc (PubChem CID 11093515) has the molecular formula C34H60Cl2NPZn and a molecular weight of 650.13 g/mol. Its IUPAC name is N-[bis[[(1R,2R,7S,8R,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl]methyl]phosphanyl]-N-ethylethanamine;dichlorozinc.
| Compound Name | N-[bis[[(1R,2R,7S,8R,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl]methyl]phosphanyl]-N-ethylethanamine;dichlorozinc |
|---|---|
| PubChem CID | 11093515 |
| Molecular Formula | C34H60Cl2NPZn |
| Molecular Weight | 650.13 g/mol |
| Exact Mass | 647.31 |
| IUPAC Name | N-[bis[[(1R,2R,7S,8R,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl]methyl]phosphanyl]-N-ethylethanamine;dichlorozinc |
| SMILES | CCN(CC)P(C[C@@H]1[C@H]2CC[C@@H]3[C@@H]2C(C)(C)CCC[C@]13C)C[C@@H]1[C@H]2CC[C@@H]3[C@@H]2C(C)(C)CCC[C@]13C.Cl[Zn]Cl |
| InChI | InChI=1S/C34H60NP.2ClH.Zn/c1-9-35(10-2)36(21-27-23-13-15-25-29(23)31(3,4)17-11-19-33(25,27)7)22-28-24-14-16-26-30(24)32(5,6)18-12-20-34(26,28)8;;;/h23-30H,9-22H2,1-8H3;2*1H;/q;;;+2/p-2/t23-,24-,25-,26-,27-,28-,29-,30-,33+,34+;;;/m1.../s1 |
| InChIKey | MTFKCJGBKDIRFS-RHXDBFFCSA-L |
| XLogP | 11.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.13 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|