C15H27F3O — CID 167197247
4-(1,1,1-trifluoro-3-methylnonan-2-yl)oxane (PubChem CID 167197247) has the molecular formula C15H27F3O and a molecular weight of 280.37 g/mol. Its IUPAC name is 4-(1,1,1-trifluoro-3-methylnonan-2-yl)oxane.
| Compound Name | 4-(1,1,1-trifluoro-3-methylnonan-2-yl)oxane |
|---|---|
| PubChem CID | 167197247 |
| Molecular Formula | C15H27F3O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 4-(1,1,1-trifluoro-3-methylnonan-2-yl)oxane |
| SMILES | CCCCCCC(C)C(C1CCOCC1)C(F)(F)F |
| InChI | InChI=1S/C15H27F3O/c1-3-4-5-6-7-12(2)14(15(16,17)18)13-8-10-19-11-9-13/h12-14H,3-11H2,1-2H3 |
| InChIKey | ZFLDZKIMYIIIST-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|