C8H14FN — CID 167199997
(1Z,3E)-4-fluoro-N-methylhepta-1,3-dien-1-amine (PubChem CID 167199997) has the molecular formula C8H14FN and a molecular weight of 143.20 g/mol. Its IUPAC name is (1Z,3E)-4-fluoro-N-methylhepta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-4-fluoro-N-methylhepta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 167199997 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | (1Z,3E)-4-fluoro-N-methylhepta-1,3-dien-1-amine |
| SMILES | CCC/C(F)=C\C=C/NC |
| InChI | InChI=1S/C8H14FN/c1-3-5-8(9)6-4-7-10-2/h4,6-7,10H,3,5H2,1-2H3/b7-4-,8-6+ |
| InChIKey | CJZTZBRGCZLCHB-ZJLRGQKUSA-N |
| XLogP | 2.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|