C12H19N3 — CID 167201846
5-N,5-N,2-trimethyl-3,4-dihydro-1H-isoquinoline-5,7-diamine (PubChem CID 167201846) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is 5-N,5-N,2-trimethyl-3,4-dihydro-1H-isoquinoline-5,7-diamine.
| Compound Name | 5-N,5-N,2-trimethyl-3,4-dihydro-1H-isoquinoline-5,7-diamine |
|---|---|
| PubChem CID | 167201846 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 5-N,5-N,2-trimethyl-3,4-dihydro-1H-isoquinoline-5,7-diamine |
| SMILES | CN1CCc2c(cc(N)cc2N(C)C)C1 |
| InChI | InChI=1S/C12H19N3/c1-14(2)12-7-10(13)6-9-8-15(3)5-4-11(9)12/h6-7H,4-5,8,13H2,1-3H3 |
| InChIKey | NEFJXOOIRFOGLO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|