C26H40N2 — CID 171517410
ethane;2,5,7-trimethyl-3,4-dihydro-1H-isoquinoline;2,6,8-trimethyl-3,4-dihydro-1H-isoquinoline (PubChem CID 171517410) has the molecular formula C26H40N2 and a molecular weight of 380.62 g/mol. Its IUPAC name is ethane;2,5,7-trimethyl-3,4-dihydro-1H-isoquinoline;2,6,8-trimethyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | ethane;2,5,7-trimethyl-3,4-dihydro-1H-isoquinoline;2,6,8-trimethyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 171517410 |
| Molecular Formula | C26H40N2 |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.32 |
| IUPAC Name | ethane;2,5,7-trimethyl-3,4-dihydro-1H-isoquinoline;2,6,8-trimethyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CC.Cc1cc(C)c2c(c1)CCN(C)C2.Cc1cc(C)c2c(c1)CN(C)CC2 |
| InChI | InChI=1S/2C12H17N.C2H6/c1-9-6-10(2)12-4-5-13(3)8-11(12)7-9;1-9-6-10(2)12-8-13(3)5-4-11(12)7-9;1-2/h2*6-7H,4-5,8H2,1-3H3;1-2H3 |
| InChIKey | GBQARLSJQJGIBN-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |