C10H13IN2 — CID 18687351
7-iodo-2-methyl-3,4-dihydro-1H-isoquinolin-5-amine (PubChem CID 18687351) has the molecular formula C10H13IN2 and a molecular weight of 288.13 g/mol. Its IUPAC name is 7-iodo-2-methyl-3,4-dihydro-1H-isoquinolin-5-amine.
| Compound Name | 7-iodo-2-methyl-3,4-dihydro-1H-isoquinolin-5-amine |
|---|---|
| PubChem CID | 18687351 |
| Molecular Formula | C10H13IN2 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 7-iodo-2-methyl-3,4-dihydro-1H-isoquinolin-5-amine |
| SMILES | CN1CCc2c(N)cc(I)cc2C1 |
| InChI | InChI=1S/C10H13IN2/c1-13-3-2-9-7(6-13)4-8(11)5-10(9)12/h4-5H,2-3,6,12H2,1H3 |
| InChIKey | TURUXQBDUIGXMG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|