C16H30N4 — CID 167201938
7-undecan-6-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 167201938) has the molecular formula C16H30N4 and a molecular weight of 278.44 g/mol. Its IUPAC name is 7-undecan-6-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 7-undecan-6-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 167201938 |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | 7-undecan-6-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | CCCCCC(CCCCC)N1CCn2cnnc2C1 |
| InChI | InChI=1S/C16H30N4/c1-3-5-7-9-15(10-8-6-4-2)19-11-12-20-14-17-18-16(20)13-19/h14-15H,3-13H2,1-2H3 |
| InChIKey | DQMXZBVATOQWLE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|