C16H31NS2 — CID 167209894
4-tert-butyl-N,N-bis(trimethyl-λ4-sulfanyl)aniline (PubChem CID 167209894) has the molecular formula C16H31NS2 and a molecular weight of 301.57 g/mol. Its IUPAC name is 4-tert-butyl-N,N-bis(trimethyl-λ4-sulfanyl)aniline.
| Compound Name | 4-tert-butyl-N,N-bis(trimethyl-λ4-sulfanyl)aniline |
|---|---|
| PubChem CID | 167209894 |
| Molecular Formula | C16H31NS2 |
| Molecular Weight | 301.57 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 4-tert-butyl-N,N-bis(trimethyl-λ4-sulfanyl)aniline |
| SMILES | CC(C)(C)c1ccc(N(S(C)(C)C)S(C)(C)C)cc1 |
| InChI | InChI=1S/C16H31NS2/c1-16(2,3)14-10-12-15(13-11-14)17(18(4,5)6)19(7,8)9/h10-13H,1-9H3 |
| InChIKey | PYRMFHQWZBWZCJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |