C27H31N3O3S — CID 167215906
6-heptan-4-yloxy-7-methoxy-N-(2-methoxy-5-thiophen-2-ylphenyl)quinazolin-4-amine (PubChem CID 167215906) has the molecular formula C27H31N3O3S and a molecular weight of 477.63 g/mol. Its IUPAC name is 6-heptan-4-yloxy-7-methoxy-N-(2-methoxy-5-thiophen-2-ylphenyl)quinazolin-4-amine.
| Compound Name | 6-heptan-4-yloxy-7-methoxy-N-(2-methoxy-5-thiophen-2-ylphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 167215906 |
| Molecular Formula | C27H31N3O3S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 6-heptan-4-yloxy-7-methoxy-N-(2-methoxy-5-thiophen-2-ylphenyl)quinazolin-4-amine |
| SMILES | CCCC(CCC)Oc1cc2c(Nc3cc(-c4cccs4)ccc3OC)ncnc2cc1OC |
| InChI | InChI=1S/C27H31N3O3S/c1-5-8-19(9-6-2)33-25-15-20-21(16-24(25)32-4)28-17-29-27(20)30-22-14-18(11-12-23(22)31-3)26-10-7-13-34-26/h7,10-17,19H,5-6,8-9H2,1-4H3,(H,28,29,30) |
| InChIKey | SNCNECLJELXZDB-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |