C27H28F2N4O3 — CID 167216065
N-[5-(2,6-difluoro-3-pyridinyl)-2-methoxyphenyl]-6-hexan-3-yloxy-7-methoxyquinazolin-4-amine (PubChem CID 167216065) has the molecular formula C27H28F2N4O3 and a molecular weight of 494.54 g/mol. Its IUPAC name is N-[5-(2,6-difluoro-3-pyridinyl)-2-methoxyphenyl]-6-hexan-3-yloxy-7-methoxyquinazolin-4-amine.
| Compound Name | N-[5-(2,6-difluoro-3-pyridinyl)-2-methoxyphenyl]-6-hexan-3-yloxy-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 167216065 |
| Molecular Formula | C27H28F2N4O3 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | N-[5-(2,6-difluoro-3-pyridinyl)-2-methoxyphenyl]-6-hexan-3-yloxy-7-methoxyquinazolin-4-amine |
| SMILES | CCCC(CC)Oc1cc2c(Nc3cc(-c4ccc(F)nc4F)ccc3OC)ncnc2cc1OC |
| InChI | InChI=1S/C27H28F2N4O3/c1-5-7-17(6-2)36-24-13-19-20(14-23(24)35-4)30-15-31-27(19)32-21-12-16(8-10-22(21)34-3)18-9-11-25(28)33-26(18)29/h8-15,17H,5-7H2,1-4H3,(H,30,31,32) |
| InChIKey | CRJWTRGTOYVEEL-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|