C21H34O3 — CID 167218103
4-oxatetracyclo[6.2.1.02,7.03,5]undecan-10-yl 2-tert-butyl-4,4-dimethylpentanoate (PubChem CID 167218103) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-10-yl 2-tert-butyl-4,4-dimethylpentanoate.
| Compound Name | 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-10-yl 2-tert-butyl-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 167218103 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-10-yl 2-tert-butyl-4,4-dimethylpentanoate |
| SMILES | CC(C)(C)CC(C(=O)OC1CC2CC1C1C2CC2OC21)C(C)(C)C |
| InChI | InChI=1S/C21H34O3/c1-20(2,3)10-14(21(4,5)6)19(22)24-15-8-11-7-13(15)17-12(11)9-16-18(17)23-16/h11-18H,7-10H2,1-6H3 |
| InChIKey | HCIYGDISCVHXLW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|