C21H40O2 — CID 126587392
[(1R,2R,5S)-2,4,4,5-tetramethylcyclohexyl] 2-tert-butyl-4,4-dimethylpentanoate (PubChem CID 126587392) has the molecular formula C21H40O2 and a molecular weight of 324.55 g/mol. Its IUPAC name is [(1R,2R,5S)-2,4,4,5-tetramethylcyclohexyl] 2-tert-butyl-4,4-dimethylpentanoate.
| Compound Name | [(1R,2R,5S)-2,4,4,5-tetramethylcyclohexyl] 2-tert-butyl-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 126587392 |
| Molecular Formula | C21H40O2 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.30 |
| IUPAC Name | [(1R,2R,5S)-2,4,4,5-tetramethylcyclohexyl] 2-tert-butyl-4,4-dimethylpentanoate |
| SMILES | C[C@@H]1CC(C)(C)[C@@H](C)C[C@H]1OC(=O)C(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C21H40O2/c1-14-12-21(9,10)15(2)11-17(14)23-18(22)16(20(6,7)8)13-19(3,4)5/h14-17H,11-13H2,1-10H3/t14-,15+,16?,17-/m1/s1 |
| InChIKey | ZVASFIBVXWCGSH-FCLJQHQZSA-N |
| XLogP | 6.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |