C20H33N — CID 167219083
N-ethenyl-5-ethyl-N,4,5-trimethyl-1-phenylheptan-2-amine (PubChem CID 167219083) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is N-ethenyl-5-ethyl-N,4,5-trimethyl-1-phenylheptan-2-amine.
| Compound Name | N-ethenyl-5-ethyl-N,4,5-trimethyl-1-phenylheptan-2-amine |
|---|---|
| PubChem CID | 167219083 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | N-ethenyl-5-ethyl-N,4,5-trimethyl-1-phenylheptan-2-amine |
| SMILES | C=CN(C)C(Cc1ccccc1)CC(C)C(C)(CC)CC |
| InChI | InChI=1S/C20H33N/c1-7-20(5,8-2)17(4)15-19(21(6)9-3)16-18-13-11-10-12-14-18/h9-14,17,19H,3,7-8,15-16H2,1-2,4-6H3 |
| InChIKey | NTYCKXKWGHNWOJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |