C31H34N6O3 — CID 167220312
[4-[3-[(4aS)-3,11-dimethyl-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][4,1]benzoxazepin-9-yl]-7H-pyrrolo[2,3-c]pyridazin-5-yl]phenyl]-morpholin-4-ylmethanone (PubChem CID 167220312) has the molecular formula C31H34N6O3 and a molecular weight of 538.65 g/mol. Its IUPAC name is [4-[3-[(4aS)-3,11-dimethyl-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][4,1]benzoxazepin-9-yl]-7H-pyrrolo[2,3-c]pyridazin-5-yl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[3-[(4aS)-3,11-dimethyl-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][4,1]benzoxazepin-9-yl]-7H-pyrrolo[2,3-c]pyridazin-5-yl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 167220312 |
| Molecular Formula | C31H34N6O3 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | [4-[3-[(4aS)-3,11-dimethyl-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][4,1]benzoxazepin-9-yl]-7H-pyrrolo[2,3-c]pyridazin-5-yl]phenyl]-morpholin-4-ylmethanone |
| SMILES | Cc1cc(-c2cc3c(-c4ccc(C(=O)N5CCOCC5)cc4)c[nH]c3nn2)cc2c1N1CCN(C)C[C@H]1COC2 |
| InChI | InChI=1S/C31H34N6O3/c1-20-13-23(14-24-18-40-19-25-17-35(2)7-8-37(25)29(20)24)28-15-26-27(16-32-30(26)34-33-28)21-3-5-22(6-4-21)31(38)36-9-11-39-12-10-36/h3-6,13-16,25H,7-12,17-19H2,1-2H3,(H,32,34)/t25-/m0/s1 |
| InChIKey | UWXAPHNEHZYKIR-VWLOTQADSA-N |
| XLogP | 3.72 |
| TPSA | 86.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |