C22H31F3N4O7 — CID 167221417
2-[2-(2-cyclopentyl-2-oxoethoxy)ethoxy]-N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]acetamide (PubChem CID 167221417) has the molecular formula C22H31F3N4O7 and a molecular weight of 520.51 g/mol. Its IUPAC name is 2-[2-(2-cyclopentyl-2-oxoethoxy)ethoxy]-N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]acetamide.
| Compound Name | 2-[2-(2-cyclopentyl-2-oxoethoxy)ethoxy]-N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 167221417 |
| Molecular Formula | C22H31F3N4O7 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 2-[2-(2-cyclopentyl-2-oxoethoxy)ethoxy]-N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]acetamide |
| SMILES | O=C(COCCOCC(=O)C1CCCC1)NC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H31F3N4O7/c23-22(24,25)17-8-26-9-18(29-17)28-14-10-36-16(21(33)20(14)32)7-27-19(31)12-35-6-5-34-11-15(30)13-3-1-2-4-13/h8-9,13-14,16,20-21,32-33H,1-7,10-12H2,(H,27,31)(H,28,29)/t14-,16+,20+,21-/m0/s1 |
| InChIKey | LDJOEVIQSQGOQF-IWMXFIMRSA-N |
| XLogP | 0.31 |
| TPSA | 152.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|