C12H13ClF3N3O5 — CID 167221862
(1S,2R,3R,4R,5S)-4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (PubChem CID 167221862) has the molecular formula C12H13ClF3N3O5 and a molecular weight of 371.70 g/mol. Its IUPAC name is (1S,2R,3R,4R,5S)-4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol.
| Compound Name | (1S,2R,3R,4R,5S)-4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
|---|---|
| PubChem CID | 167221862 |
| Molecular Formula | C12H13ClF3N3O5 |
| Molecular Weight | 371.70 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | (1S,2R,3R,4R,5S)-4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| SMILES | OC[C@@]12CO[C@@H](O1)[C@H](Nc1ncc(C(F)(F)F)c(Cl)n1)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C12H13ClF3N3O5/c13-8-4(12(14,15)16)1-17-10(19-8)18-5-6(21)7(22)11(2-20)3-23-9(5)24-11/h1,5-7,9,20-22H,2-3H2,(H,17,18,19)/t5-,6-,7-,9+,11+/m1/s1 |
| InChIKey | DCBMONYGMYGBHZ-VBGZFMGZSA-N |
| XLogP | -0.23 |
| TPSA | 116.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.70 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |