C20H28F3N3O5 — CID 167221972
tert-butyl N-[(3aS,4R,7S,7aR)-4-ethyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-N-[6-(trifluoromethyl)pyrazin-2-yl]carbamate (PubChem CID 167221972) has the molecular formula C20H28F3N3O5 and a molecular weight of 447.45 g/mol. Its IUPAC name is tert-butyl N-[(3aS,4R,7S,7aR)-4-ethyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-N-[6-(trifluoromethyl)pyrazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(3aS,4R,7S,7aR)-4-ethyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-N-[6-(trifluoromethyl)pyrazin-2-yl]carbamate |
|---|---|
| PubChem CID | 167221972 |
| Molecular Formula | C20H28F3N3O5 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | tert-butyl N-[(3aS,4R,7S,7aR)-4-ethyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-N-[6-(trifluoromethyl)pyrazin-2-yl]carbamate |
| SMILES | CC[C@H]1OC[C@H](N(C(=O)OC(C)(C)C)c2cncc(C(F)(F)F)n2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C20H28F3N3O5/c1-7-12-16-15(29-19(5,6)30-16)11(10-28-12)26(17(27)31-18(2,3)4)14-9-24-8-13(25-14)20(21,22)23/h8-9,11-12,15-16H,7,10H2,1-6H3/t11-,12+,15+,16-/m0/s1 |
| InChIKey | LFWCKECGMUQZMG-OJDYBEQGSA-N |
| XLogP | 3.93 |
| TPSA | 83.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |