C21H32NO9P — CID 167225713
[(2R)-2-acetyloxy-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy-phenylmethoxyphosphanyl]oxypropyl] acetate (PubChem CID 167225713) has the molecular formula C21H32NO9P and a molecular weight of 473.46 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy-phenylmethoxyphosphanyl]oxypropyl] acetate.
| Compound Name | [(2R)-2-acetyloxy-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy-phenylmethoxyphosphanyl]oxypropyl] acetate |
|---|---|
| PubChem CID | 167225713 |
| Molecular Formula | C21H32NO9P |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | [(2R)-2-acetyloxy-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy-phenylmethoxyphosphanyl]oxypropyl] acetate |
| SMILES | CC(=O)OC[C@H](COP(OCCNC(=O)OC(C)(C)C)OCc1ccccc1)OC(C)=O |
| InChI | InChI=1S/C21H32NO9P/c1-16(23)26-14-19(30-17(2)24)15-29-32(28-13-18-9-7-6-8-10-18)27-12-11-22-20(25)31-21(3,4)5/h6-10,19H,11-15H2,1-5H3,(H,22,25)/t19-,32?/m1/s1 |
| InChIKey | PDGPUWISAHEFIR-XHYMPFLFSA-N |
| XLogP | 3.48 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|