C28H28FN5O2 — CID 167225940
N-(2-amino-5-fluorophenyl)-4-[(1S)-1-[3-[4-[(dimethylamino)methyl]phenyl]-6-oxopyridazin-1-yl]ethyl]benzamide (PubChem CID 167225940) has the molecular formula C28H28FN5O2 and a molecular weight of 485.56 g/mol. Its IUPAC name is N-(2-amino-5-fluorophenyl)-4-[(1S)-1-[3-[4-[(dimethylamino)methyl]phenyl]-6-oxopyridazin-1-yl]ethyl]benzamide.
| Compound Name | N-(2-amino-5-fluorophenyl)-4-[(1S)-1-[3-[4-[(dimethylamino)methyl]phenyl]-6-oxopyridazin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 167225940 |
| Molecular Formula | C28H28FN5O2 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | N-(2-amino-5-fluorophenyl)-4-[(1S)-1-[3-[4-[(dimethylamino)methyl]phenyl]-6-oxopyridazin-1-yl]ethyl]benzamide |
| SMILES | C[C@@H](c1ccc(C(=O)Nc2cc(F)ccc2N)cc1)n1nc(-c2ccc(CN(C)C)cc2)ccc1=O |
| InChI | InChI=1S/C28H28FN5O2/c1-18(20-8-10-22(11-9-20)28(36)31-26-16-23(29)12-13-24(26)30)34-27(35)15-14-25(32-34)21-6-4-19(5-7-21)17-33(2)3/h4-16,18H,17,30H2,1-3H3,(H,31,36)/t18-/m0/s1 |
| InChIKey | ODAHKZVTGCELCP-SFHVURJKSA-N |
| XLogP | 4.55 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|