C12H13N3O — CID 167227232
10-tert-butyl-2,5,10-triazabicyclo[6.3.0]undeca-1(8),2,3,5,6-pentaen-9-one (PubChem CID 167227232) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 10-tert-butyl-2,5,10-triazabicyclo[6.3.0]undeca-1(8),2,3,5,6-pentaen-9-one.
| Compound Name | 10-tert-butyl-2,5,10-triazabicyclo[6.3.0]undeca-1(8),2,3,5,6-pentaen-9-one |
|---|---|
| PubChem CID | 167227232 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 10-tert-butyl-2,5,10-triazabicyclo[6.3.0]undeca-1(8),2,3,5,6-pentaen-9-one |
| SMILES | CC(C)(C)N1CC2=C(C=C=NC=C=N2)C1=O |
| InChI | InChI=1S/C12H13N3O/c1-12(2,3)15-8-10-9(11(15)16)4-5-13-6-7-14-10/h4,6H,8H2,1-3H3 |
| InChIKey | VQTNSLFPXDXDBW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |