C15H19ClN2O3 — CID 167229271
tert-butyl N-[3-[(1S,2S)-2-carbamoylcyclopropyl]-5-chlorophenyl]carbamate (PubChem CID 167229271) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is tert-butyl N-[3-[(1S,2S)-2-carbamoylcyclopropyl]-5-chlorophenyl]carbamate.
| Compound Name | tert-butyl N-[3-[(1S,2S)-2-carbamoylcyclopropyl]-5-chlorophenyl]carbamate |
|---|---|
| PubChem CID | 167229271 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | tert-butyl N-[3-[(1S,2S)-2-carbamoylcyclopropyl]-5-chlorophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(Cl)cc([C@H]2C[C@@H]2C(N)=O)c1 |
| InChI | InChI=1S/C15H19ClN2O3/c1-15(2,3)21-14(20)18-10-5-8(4-9(16)6-10)11-7-12(11)13(17)19/h4-6,11-12H,7H2,1-3H3,(H2,17,19)(H,18,20)/t11-,12+/m1/s1 |
| InChIKey | ULXUSVRCFQLSKG-NEPJUHHUSA-N |
| XLogP | 3.28 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |