C10H14N2O2S — CID 167230031
4-[(6-methyl-2-pyridinyl)imino]-1,4-oxathiane 4-oxide (PubChem CID 167230031) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 4-[(6-methyl-2-pyridinyl)imino]-1,4-oxathiane 4-oxide.
| Compound Name | 4-[(6-methyl-2-pyridinyl)imino]-1,4-oxathiane 4-oxide |
|---|---|
| PubChem CID | 167230031 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 4-[(6-methyl-2-pyridinyl)imino]-1,4-oxathiane 4-oxide |
| SMILES | Cc1cccc(N=S2(=O)CCOCC2)n1 |
| InChI | InChI=1S/C10H14N2O2S/c1-9-3-2-4-10(11-9)12-15(13)7-5-14-6-8-15/h2-4H,5-8H2,1H3 |
| InChIKey | SHEXZNCODZZWOV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |