About 4-[(6-methyl-2-pyridinyl)imino]-1,4-oxathiane 4-oxide
4-[(6-methyl-2-pyridinyl)imino]-1,4-oxathiane 4-oxide (PubChem CID 167230031) has the molecular formula C10H14N2O2S
and a molecular weight of 226.30 g/mol. Its IUPAC name is 4-[(6-methyl-2-pyridinyl)imino]-1,4-oxathiane 4-oxide.
Molecular Properties
| Compound Name | 4-[(6-methyl-2-pyridinyl)imino]-1,4-oxathiane 4-oxide |
| PubChem CID | 167230031 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 4-[(6-methyl-2-pyridinyl)imino]-1,4-oxathiane 4-oxide |
| SMILES | Cc1cccc(N=S2(=O)CCOCC2)n1 |
| InChI | InChI=1S/C10H14N2O2S/c1-9-3-2-4-10(11-9)12-15(13)7-5-14-6-8-15/h2-4H,5-8H2,1H3 |
| InChIKey | SHEXZNCODZZWOV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(6-methyl-2-pyridinyl)imino]-1,4-oxathiane 4-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6-methyl-2-pyridinyl)imino]-1,4-oxathiane 4-oxide?
The IUPAC name of 4-[(6-methyl-2-pyridinyl)imino]-1,4-oxathiane 4-oxide (CID 167230031) is 4-[(6-methyl-2-pyridinyl)imino]-1,4-oxathiane 4-oxide.
What is the SMILES notation for 4-[(6-methyl-2-pyridinyl)imino]-1,4-oxathiane 4-oxide?
The canonical SMILES for 4-[(6-methyl-2-pyridinyl)imino]-1,4-oxathiane 4-oxide is Cc1cccc(N=S2(=O)CCOCC2)n1.
What is the InChIKey of 4-[(6-methyl-2-pyridinyl)imino]-1,4-oxathiane 4-oxide?
The InChIKey is SHEXZNCODZZWOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2S/c1-9-3-2-4-10(11-9)12-15(13)7-5-14-6-8-15/h2-4H,5-8H2,1H3.
What are the key properties of 4-[(6-methyl-2-pyridinyl)imino]-1,4-oxathiane 4-oxide?
4-[(6-methyl-2-pyridinyl)imino]-1,4-oxathiane 4-oxide has a molecular weight of 226.30 g/mol, XLogP of 1.52, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-methyl-2-pyridinyl)imino]-1,4-oxathiane 4-oxide is sourced from PubChem (CID 167230031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).