C24H26N6O2S — CID 167231121
2-[3-(4-hydroxybut-1-en-2-ylamino)sulfanylanilino]-5,8,11-trimethylpyrimido[4,5-b][1,4]benzodiazepin-6-one (PubChem CID 167231121) has the molecular formula C24H26N6O2S and a molecular weight of 462.58 g/mol. Its IUPAC name is 2-[3-(4-hydroxybut-1-en-2-ylamino)sulfanylanilino]-5,8,11-trimethylpyrimido[4,5-b][1,4]benzodiazepin-6-one.
| Compound Name | 2-[3-(4-hydroxybut-1-en-2-ylamino)sulfanylanilino]-5,8,11-trimethylpyrimido[4,5-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 167231121 |
| Molecular Formula | C24H26N6O2S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 2-[3-(4-hydroxybut-1-en-2-ylamino)sulfanylanilino]-5,8,11-trimethylpyrimido[4,5-b][1,4]benzodiazepin-6-one |
| SMILES | C=C(CCO)NSc1cccc(Nc2ncc3c(n2)N(C)c2ccc(C)cc2C(=O)N3C)c1 |
| InChI | InChI=1S/C24H26N6O2S/c1-15-8-9-20-19(12-15)23(32)30(4)21-14-25-24(27-22(21)29(20)3)26-17-6-5-7-18(13-17)33-28-16(2)10-11-31/h5-9,12-14,28,31H,2,10-11H2,1,3-4H3,(H,25,26,27) |
| InChIKey | YXTDGDPHIMXCCS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|