C26H31N7O2S — CID 145382356
acetaldehyde;5,8,11-trimethyl-2-[3-[(1-methylazetidin-3-yl)amino]sulfanylanilino]pyrimido[4,5-b][1,4]benzodiazepin-6-one (PubChem CID 145382356) has the molecular formula C26H31N7O2S and a molecular weight of 505.65 g/mol. Its IUPAC name is acetaldehyde;5,8,11-trimethyl-2-[3-[(1-methylazetidin-3-yl)amino]sulfanylanilino]pyrimido[4,5-b][1,4]benzodiazepin-6-one.
| Compound Name | acetaldehyde;5,8,11-trimethyl-2-[3-[(1-methylazetidin-3-yl)amino]sulfanylanilino]pyrimido[4,5-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 145382356 |
| Molecular Formula | C26H31N7O2S |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | acetaldehyde;5,8,11-trimethyl-2-[3-[(1-methylazetidin-3-yl)amino]sulfanylanilino]pyrimido[4,5-b][1,4]benzodiazepin-6-one |
| SMILES | CC=O.Cc1ccc2c(c1)C(=O)N(C)c1cnc(Nc3cccc(SNC4CN(C)C4)c3)nc1N2C |
| InChI | InChI=1S/C24H27N7OS.C2H4O/c1-15-8-9-20-19(10-15)23(32)31(4)21-12-25-24(27-22(21)30(20)3)26-16-6-5-7-18(11-16)33-28-17-13-29(2)14-17;1-2-3/h5-12,17,28H,13-14H2,1-4H3,(H,25,26,27);2H,1H3 |
| InChIKey | FMRFHJJEQNQAKX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|