C20H20N6OS — CID 167231813
2-(3-aminosulfanylanilino)-5,8,11-trimethylpyrimido[4,5-b][1,4]benzodiazepin-6-one (PubChem CID 167231813) has the molecular formula C20H20N6OS and a molecular weight of 392.49 g/mol. Its IUPAC name is 2-(3-aminosulfanylanilino)-5,8,11-trimethylpyrimido[4,5-b][1,4]benzodiazepin-6-one.
| Compound Name | 2-(3-aminosulfanylanilino)-5,8,11-trimethylpyrimido[4,5-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 167231813 |
| Molecular Formula | C20H20N6OS |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-(3-aminosulfanylanilino)-5,8,11-trimethylpyrimido[4,5-b][1,4]benzodiazepin-6-one |
| SMILES | Cc1ccc2c(c1)C(=O)N(C)c1cnc(Nc3cccc(SN)c3)nc1N2C |
| InChI | InChI=1S/C20H20N6OS/c1-12-7-8-16-15(9-12)19(27)26(3)17-11-22-20(24-18(17)25(16)2)23-13-5-4-6-14(10-13)28-21/h4-11H,21H2,1-3H3,(H,22,23,24) |
| InChIKey | BSEAUBHRFYQVKN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|