C22H32N6O — CID 167231453
4-[[4-[(1E)-1-(ethylamino)buta-1,3-dienyl]piperazin-1-yl]methyl]-2-methoxy-5-(1-methylpyrazol-4-yl)aniline (PubChem CID 167231453) has the molecular formula C22H32N6O and a molecular weight of 396.54 g/mol. Its IUPAC name is 4-[[4-[(1E)-1-(ethylamino)buta-1,3-dienyl]piperazin-1-yl]methyl]-2-methoxy-5-(1-methylpyrazol-4-yl)aniline.
| Compound Name | 4-[[4-[(1E)-1-(ethylamino)buta-1,3-dienyl]piperazin-1-yl]methyl]-2-methoxy-5-(1-methylpyrazol-4-yl)aniline |
|---|---|
| PubChem CID | 167231453 |
| Molecular Formula | C22H32N6O |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 4-[[4-[(1E)-1-(ethylamino)buta-1,3-dienyl]piperazin-1-yl]methyl]-2-methoxy-5-(1-methylpyrazol-4-yl)aniline |
| SMILES | C=C/C=C(\NCC)N1CCN(Cc2cc(OC)c(N)cc2-c2cnn(C)c2)CC1 |
| InChI | InChI=1S/C22H32N6O/c1-5-7-22(24-6-2)28-10-8-27(9-11-28)16-17-12-21(29-4)20(23)13-19(17)18-14-25-26(3)15-18/h5,7,12-15,24H,1,6,8-11,16,23H2,2-4H3/b22-7+ |
| InChIKey | QZRAAIPUIQETFO-QPJQQBGISA-N |
| XLogP | 2.43 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|