C22H32N8O — CID 170258387
4-[4-[N-[(Z)-2-(dimethylamino)-2-(methylideneamino)ethenyl]-C-methylcarbonimidoyl]piperazin-1-yl]-2-methoxy-5-(1-methylpyrazol-4-yl)aniline (PubChem CID 170258387) has the molecular formula C22H32N8O and a molecular weight of 424.55 g/mol. Its IUPAC name is 4-[4-[N-[(Z)-2-(dimethylamino)-2-(methylideneamino)ethenyl]-C-methylcarbonimidoyl]piperazin-1-yl]-2-methoxy-5-(1-methylpyrazol-4-yl)aniline.
| Compound Name | 4-[4-[N-[(Z)-2-(dimethylamino)-2-(methylideneamino)ethenyl]-C-methylcarbonimidoyl]piperazin-1-yl]-2-methoxy-5-(1-methylpyrazol-4-yl)aniline |
|---|---|
| PubChem CID | 170258387 |
| Molecular Formula | C22H32N8O |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | 4-[4-[N-[(Z)-2-(dimethylamino)-2-(methylideneamino)ethenyl]-C-methylcarbonimidoyl]piperazin-1-yl]-2-methoxy-5-(1-methylpyrazol-4-yl)aniline |
| SMILES | C=N/C(=C\N=C(/C)N1CCN(c2cc(OC)c(N)cc2-c2cnn(C)c2)CC1)N(C)C |
| InChI | InChI=1S/C22H32N8O/c1-16(25-14-22(24-2)27(3)4)29-7-9-30(10-8-29)20-12-21(31-6)19(23)11-18(20)17-13-26-28(5)15-17/h11-15H,2,7-10,23H2,1,3-6H3/b22-14+,25-16+ |
| InChIKey | QIDHAHPSBGPIPE-IEWXFJLUSA-N |
| XLogP | 2.28 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|