C9H11FN2OS — CID 167232867
2-amino-4-fluoro-N,N-dimethyl-5-sulfanylbenzamide (PubChem CID 167232867) has the molecular formula C9H11FN2OS and a molecular weight of 214.27 g/mol. Its IUPAC name is 2-amino-4-fluoro-N,N-dimethyl-5-sulfanylbenzamide.
| Compound Name | 2-amino-4-fluoro-N,N-dimethyl-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 167232867 |
| Molecular Formula | C9H11FN2OS |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2-amino-4-fluoro-N,N-dimethyl-5-sulfanylbenzamide |
| SMILES | CN(C)C(=O)c1cc(S)c(F)cc1N |
| InChI | InChI=1S/C9H11FN2OS/c1-12(2)9(13)5-3-8(14)6(10)4-7(5)11/h3-4,14H,11H2,1-2H3 |
| InChIKey | APUYUKXTPSLUML-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|