C31H39N7O2 — CID 167233148
2-[[6-(2,8-diazaspiro[4.5]decan-8-yl)-5-ethenyl-2-pyridin-4-ylpyrimidin-4-yl]methylideneamino]-N-[(2,4-dimethoxyphenyl)methyl]ethanamine (PubChem CID 167233148) has the molecular formula C31H39N7O2 and a molecular weight of 541.70 g/mol. Its IUPAC name is 2-[[6-(2,8-diazaspiro[4.5]decan-8-yl)-5-ethenyl-2-pyridin-4-ylpyrimidin-4-yl]methylideneamino]-N-[(2,4-dimethoxyphenyl)methyl]ethanamine.
| Compound Name | 2-[[6-(2,8-diazaspiro[4.5]decan-8-yl)-5-ethenyl-2-pyridin-4-ylpyrimidin-4-yl]methylideneamino]-N-[(2,4-dimethoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 167233148 |
| Molecular Formula | C31H39N7O2 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | 2-[[6-(2,8-diazaspiro[4.5]decan-8-yl)-5-ethenyl-2-pyridin-4-ylpyrimidin-4-yl]methylideneamino]-N-[(2,4-dimethoxyphenyl)methyl]ethanamine |
| SMILES | C=Cc1c(/C=N/CCNCc2ccc(OC)cc2OC)nc(-c2ccncc2)nc1N1CCC2(CCNC2)CC1 |
| InChI | InChI=1S/C31H39N7O2/c1-4-26-27(21-34-16-15-33-20-24-5-6-25(39-2)19-28(24)40-3)36-29(23-7-12-32-13-8-23)37-30(26)38-17-10-31(11-18-38)9-14-35-22-31/h4-8,12-13,19,21,33,35H,1,9-11,14-18,20,22H2,2-3H3/b34-21+ |
| InChIKey | IEGGIKHYETZDBH-KEIPNQJHSA-N |
| XLogP | 3.99 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|