C25H28N6O — CID 167233262
4-[4-(2,8-diazaspiro[4.5]decan-8-yl)-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-8-yl]-2-methylbut-3-yn-2-ol (PubChem CID 167233262) has the molecular formula C25H28N6O and a molecular weight of 428.54 g/mol. Its IUPAC name is 4-[4-(2,8-diazaspiro[4.5]decan-8-yl)-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-8-yl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[4-(2,8-diazaspiro[4.5]decan-8-yl)-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-8-yl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 167233262 |
| Molecular Formula | C25H28N6O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 4-[4-(2,8-diazaspiro[4.5]decan-8-yl)-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-8-yl]-2-methylbut-3-yn-2-ol |
| SMILES | CC(C)(O)C#Cc1nccc2c(N3CCC4(CCNC4)CC3)nc(-c3ccncc3)nc12 |
| InChI | InChI=1S/C25H28N6O/c1-24(2,32)7-3-20-21-19(6-13-28-20)23(30-22(29-21)18-4-11-26-12-5-18)31-15-9-25(10-16-31)8-14-27-17-25/h4-6,11-13,27,32H,8-10,14-17H2,1-2H3 |
| InChIKey | MGFHADDFHCTENL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|