C23H27N5O6 — CID 167233354
tert-butyl N-[N-[2-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)ethylcarbamoyl]-N'-phenylcarbamimidoyl]carbamate (PubChem CID 167233354) has the molecular formula C23H27N5O6 and a molecular weight of 469.50 g/mol. Its IUPAC name is tert-butyl N-[N-[2-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)ethylcarbamoyl]-N'-phenylcarbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N-[2-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)ethylcarbamoyl]-N'-phenylcarbamimidoyl]carbamate |
|---|---|
| PubChem CID | 167233354 |
| Molecular Formula | C23H27N5O6 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | tert-butyl N-[N-[2-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)ethylcarbamoyl]-N'-phenylcarbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N/C(=N\c1ccccc1)NC(=O)NCCN1C(=O)C2C3C=CC(O3)C2C1=O |
| InChI | InChI=1S/C23H27N5O6/c1-23(2,3)34-22(32)27-20(25-13-7-5-4-6-8-13)26-21(31)24-11-12-28-18(29)16-14-9-10-15(33-14)17(16)19(28)30/h4-10,14-17H,11-12H2,1-3H3,(H3,24,25,26,27,31,32) |
| InChIKey | LKPRZYNSKNBFOX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|