C24H28N2O7 — CID 166518407
tert-butyl N-[2-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)-3-(2-formyl-3-methylphenoxy)propyl]carbamate (PubChem CID 166518407) has the molecular formula C24H28N2O7 and a molecular weight of 456.50 g/mol. Its IUPAC name is tert-butyl N-[2-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)-3-(2-formyl-3-methylphenoxy)propyl]carbamate.
| Compound Name | tert-butyl N-[2-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)-3-(2-formyl-3-methylphenoxy)propyl]carbamate |
|---|---|
| PubChem CID | 166518407 |
| Molecular Formula | C24H28N2O7 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | tert-butyl N-[2-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)-3-(2-formyl-3-methylphenoxy)propyl]carbamate |
| SMILES | Cc1cccc(OCC(CNC(=O)OC(C)(C)C)N2C(=O)C3C4C=CC(O4)C3C2=O)c1C=O |
| InChI | InChI=1S/C24H28N2O7/c1-13-6-5-7-16(15(13)11-27)31-12-14(10-25-23(30)33-24(2,3)4)26-21(28)19-17-8-9-18(32-17)20(19)22(26)29/h5-9,11,14,17-20H,10,12H2,1-4H3,(H,25,30) |
| InChIKey | DRQIPWHMCDWUSK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|