C19H26N2O4 — CID 101341777
tert-butyl N-[2-[(1S,2S,6R,7R)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]carbamate (PubChem CID 101341777) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is tert-butyl N-[2-[(1S,2S,6R,7R)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(1S,2S,6R,7R)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 101341777 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | tert-butyl N-[2-[(1S,2S,6R,7R)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]carbamate |
| SMILES | CC(C)=C1[C@H]2C=C[C@@H]1[C@H]1C(=O)N(CCNC(=O)OC(C)(C)C)C(=O)[C@H]12 |
| InChI | InChI=1S/C19H26N2O4/c1-10(2)13-11-6-7-12(13)15-14(11)16(22)21(17(15)23)9-8-20-18(24)25-19(3,4)5/h6-7,11-12,14-15H,8-9H2,1-5H3,(H,20,24)/t11-,12+,14+,15- |
| InChIKey | NKRORZJBATWNOP-IKARSPCKSA-N |
| XLogP | 2.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|